![[ICO]](/icons/blank.gif) | Name | Size |
|---|
![[DIR]](/icons/back.gif) | Parent Directory | - |
![[DIR]](/icons/dir.png) | Advances in chemical physics/ | - |
| Advances in physical organic chemistry/ | - |
| Biochemistry/ | - |
| Chemical kinetics/ | - |
| Computational/ | - |
| Mathematical chemistry/ | - |
| Physical chemistry/ | - |
| Quantum chemistry/ | - |
| Thermodynamics/ | - |
![[PDF]](/icons/pdf.png) | A primer for the Monte Carlo method 1994 - Sobol.pdf | 3.1M |
| Atmospheric chemistry and physics.pdf | 64M |
![[DOC]](/icons/quill.png) | Computational physics - Landau & Paez Mejia.rar | 7.8M |
| Design and use of relational databases in chemistry 2009 - Donnell.pdf | 2.2M |
| Developing chemical information systems 2007 - Li.pdf | 2.6M |
| Exploring chemistry with electronic structure methods 2ed - Foresman & Frisch.pdf | 12M |
| Handbook for estimating physicochemical properties of organic compounds 1999 - Reinhard & Drefahl.pdf | 9.6M |
| Interfacial supramolecular assemblies 2003 - Forster & Keyes.pdf | 3.6M |
![[IMG]](/icons/image2.png) | Introduction to supramolecular chemistry - Dodziuk.djvu | 7.4M |
| Ionic liquids in synthesis - Wasserscheid & Welton.pdf | 25M |
| Modern nuclear chemistry 2006 - Loveland, Morrissey & Seaborg.pdf | 16M |
| Molecular electronics 2003 - Tour.pdf | 21M |
| Nuclear fission and cluster radioactivity 2005 - Hooshyar, Reichstein & Malik.pdf | 2.8M |
| Prediction of protein structures, functions and interactions 2009 - Bujnicki.pdf | 4.8M |
| Theoretical organic chemistry 1998 - Parkanyi.pdf | 31M |
