![[ICO]](/icons/blank.gif) | Name | Size |
|---|
![[DIR]](/icons/back.gif) | Parent Directory | - |
![[DIR]](/icons/dir.png) | Comprehensive coordination chemistry II/ | - |
| Inorganic and theoretical chemistry - Mellor/ | - |
![[PDF]](/icons/pdf.png) | A guide to chalogen-nitrogen chemistry 2005 - Chivers.pdf | 4.5M |
| Binary rare earth oxydes 2004 - Adachi, Imanaka & Kang.pdf | 11M |
| Boronic acids - Preparation and applications in organic synthesis and medicine 2005 - Hall.pdf | 6.6M |
| Chemistry of Precious Metals 1997 - Cotton.pdf | 15M |
![[IMG]](/icons/image2.png) | Chemistry of the elements - Greenwood & Earnshaw.djvu | 22M |
| Chemistry of the rarer elements - Hopkins.pdf | 8.2M |
| Corrosion science and technology - Talbot & Talbot.pdf | 2.9M |
| Fullerenes - Chemistry and reactions 2005 - Hirsch & Brettreich.pdf | 11M |
| Handbook of carbon, graphite, diamond and fullerenes 1993 - Pierson.pdf | 4.7M |
| Handbook of inorganic chemicals 2003 - Patnaik.pdf | 6.4M |
| Handbook of preparative inorganic chemistry 1963 - Vol 1,2 - Brauer.pdf | 19M |
| Hypervalent iodine chemistry.pdf | 4.3M |
| Inorganic chemistry 2ed 2004 - Cox.pdf | 4.9M |
| Inorganic chemistry 3ed - Miessler & Tarr.djvu | 13M |
| Inorganic chemistry 3ed - Miessler & Tarr.pdf | 27M |
| Inorganic chemistry 5ed - Shriver Atkins.pdf | 31M |
| Inorganic chemistry 2008 - House.pdf | 6.6M |
| Inorganic laboratory preparations 1962 - Schlessinger.djvu | 4.3M |
| Inorganic preparations - Henderson & Fernelius.djvu | 1.4M |
| Inorganic preparations - Walton.djvu | 1.6M |
| Inorganic structural chemistry 2ed 2006 - Muller.pdf | 13M |
| Metal oxide chemistry and synthesis 3ed 1994 - Jolivet.pdf | 9.9M |
| Modern coordination chemistry 2002 - Leigh & Winterton.pdf | 26M |
| Modern inorganic chemistry - Chambers & Holliday.djvu | 4.6M |
| Modern inorganic chemistry - Chambers & Holliday.pdf | 19M |
| Ozone 1920 - Rideal.pdf | 4.5M |
| Physics and chemistry of the inorganic azides - Fair & Walker - INCOMPLETE.pdf | 2.6M |
| Practical inorganic chemistry 1984 - Vorobyova, Dunaeva, Ippolitova & Tamm.djvu | 2.9M |
| Practical inorganic chemistry 1984 - Vorobyova, Dunaeva, Ippolitova & Tamm.pdf | 14M |
| Selections from inorganic syntheses - Vol 1-5.djvu | 4.4M |
| Sulfuric acid manufacture - Davenport & King.pdf | 13M |
| Superacid chemistry 2ed 2009 - Olah.pdf | 16M |
| Synthetic inorganic chemistry 5ed - Blanchard, Phelan & Davis.pdf | 2.1M |
| The chemical bond in inorganic chemistry 2002 - Brown.pdf | 12M |
| The chemistry and literature of beryllium 1909 - Parsons.pdf | 2.9M |
| The chemistry of halides, pseudo-halides and azides Vol 1 & 2 1995 - Patai & Rappoport.djvu | 20M |
| The chemistry of the thiol group Part 2 1974 - Patai.pdf | 19M |
| The silicates in chemistry and commerce - Asch & Asch.pdf | 9.2M |
| Tungsten 1999 - Lassner & Schubert.pdf | 22M |
| Verified syntheses of zeolitic materials 2ed 2001 - Robson.pdf | 7.4M |
