![[ICO]](/icons/blank.gif) | Name | Size |
|---|
![[DIR]](/icons/back.gif) | Parent Directory | - |
![[PDF]](/icons/pdf.png) | Vol 1 -Potential and challenges.pdf | 32M |
| Vol 2 -Efficacy, safety and clinical evaluation 1.pdf | 28M |
| Vol 3 -Efficacy, safety and clinical evaluation 2.pdf | 37M |
| Vol 4 -Antioxidants and naturaceuticals.pdf | 30M |
| Vol 5 -Immune modulation and vaccine adjuvants.pdf | 39M |
| Vol 6 -Extraction, isolation and characterization.pdf | 31M |
| Vol 7 -Structural modifications and drug development.pdf | 21M |
| Vol 8 -Quality control and standardization.pdf | 25M |
