![[ICO]](/icons/blank.gif) | Name | Size |
|---|
![[DIR]](/icons/back.gif) | Parent Directory | - |
![[PDF]](/icons/pdf.png) | 21st_Century_Political_Science__A_Reference_Handbook.pdf | 6.9M |
| AFAR-PERCEPTION and REALITY after 1991.pdf | 17K |
| APSA_Donor Contribution to the Strengthening.pdf | 869K |
| ASEAN Political Security.pdf | 198K |
| AU's Peacekeeping Operations.pdf | 470K |
| AU.pdf | 3.4M |
| A_Companion_to_International_History_1900_2001__Blackwell_Companions_to_History_.pdf | 5.4M |
| A_Human_Security_Doctrine_for_Europe__Project__Principles__Practicalities__Routledge_Advances_in_International_Relations_and_Global_Politics_.pdf | 1.5M |
| A_Preface_to_Democratic_Theory__Expanded_Edition.pdf | 9.9M |
| Addis Ababa University in the Shadow of the Derg.pdf | 196K |
| Addressing Social Change in Situations of Violent Conflict.pdf | 227K |
| Advancing Democratic Governance.pdf | 164K |
| Adverse Incorporation_Social Exclusion and Chronic Poverty.pdf | 355K |
| Al-Ahbash and Wahabiya.pdf | 540K |
| Al-Quida Misadventure.pdf | 9.0M |
| Alternative Dispute Resolution.pdf | 2.3M |
| Alternative Dispute Resolution 2.pdf | 659K |
| American Federalism.pdf | 2.7M |
| American_Exceptionalism_and_U_S__Foreign_Policy__Public_Diplomacy_at_the_End_of_the_Cold_War.pdf | 1.2M |
| An_Introduction_to_European_Foreign_Policy.pdf | 1.3M |
| An_introduction_to_conflict-sensitive_approaches(chapter1).pdf | 464K |
| Analysing_Middle_Eastern_Foreign_Policies__The_Relationship_With_Europe.pdf | 1.6M |
| Anatomy of a Conflict, Afar and Isa.pdf | 1.3M |
| Anthology of Peace and Security Research.pdf | 4.6M |
| Aplying_Fuzzy_Mathematics_to_Formal_Models_in_Comparative_Politics.pdf | 3.9M |
| Applications of IHL.pdf | 365K |
| Applied Conflict Transformation Studies.pdf | 671K |
| Applying_conflict_sensitivity_at_project_and_programme_level_(chapter_3).pdf | 344K |
| Approaches__Levels__and_Methods_of_Analysis_in_International_Politics__Crossing_Boundaries__Advances_in_Foreign_Policy_Analysis_.pdf | 1.2M |
| Approache to Conflict Transformation.pdf | 1.0M |
| Approaching Social Change.pdf | 206K |
| Arab-Israeli Conflict.pdf | 535K |
| Arab_Israeli Conflict.pdf | 544K |
| Arab_Israeli Conflict_the Solution.pdf | 599K |
| Are the Shite Arising.pdf | 66K |
| Armed Conflict and Its International Dimension.pdf | 185K |
| As_Pastoralists_Settle__Social__Health__and_Economic_Consequences_of_the_Pastoral_Sedentarization_in_Marsabit_District__Kenya__Studies_in_Human_Ecolog.pdf | 3.8M |
| Aspect of Crimes Against Humanity.pdf | 71K |
| Assessing the State-of-the-Art in Conflict Transformation.pdf | 397K |
| Atlas_of_the_Arab_Israeli_Conflict__Routledge_Historical_Atlases_.pdf | 10M |
| Atse Menilik.pdf | 13M |
| Authoritarianism_in_an_Age_of_Democratization.pdf | 2.2M |
| Autonomy__Self_Governance_and_Conflict_Resolution__Innovative_approaches_to_Institutional_Design_in_Divided_Societies.pdf | 1.9M |
| Autonomy_and_Ethnicity__Negotiating_Competing_Claims_in_Multi_Ethnic_States__Cambridge_Studies_in_Law_and_Society_.pdf | 9.3M |
| Back_door_to_war__The_Roosevelt_foreign_policy__1933_1941.pdf | 13M |
| Beliefs_and_Leadership_in_World_Politics__Methods_and_Applications_of_Operational_Code_Analysis__Advances_in_Foreign_Policy_Analysis_.pdf | 1.0M |
| Beyond Greed and Grievance.pdf | 142K |
| Beyond_the_World_Bank_Agenda__An_Institutional_Approach_to_Development.pdf | 1.5M |
| Bibliography_Peacekeeping.pdf | 603K |
| Bibliography on Islam.pdf | 1.1M |
| Blood_Diamonds__Tracing_The_Deadly_Path_Of_The_World__039_s_Most_Precious_Stones.pdf | 11M |
| Brazil's Decentralized Federalism.pdf | 2.5M |
| British Party Politics.pdf | 1.2M |
| Building Peace in the Absence of States.pdf | 1.0M |
| Building_Democracy___The_International_Dimension_of_Democratisation_in_Eastern_Europe.pdf | 9.4M |
| Building_Democratic_Institutions__Governance_Reform_In_Developing_Countries.pdf | 54M |
| Can Ethnic Federalism Prevent Conflict.pdf | 305K |
| Candidate_Strategies_and_Electoral_Competition_in_the_Russian_Federation__Democracy_without_Foundation__Cambridge_Studies_in_Comparative_Politics_.pdf | 1.2M |
| Capitalism__Democracy__and_Welfare__Cambridge_Studies_in_Comparative_Politics_.pdf | 3.0M |
| Cascades of Ethnic Polarization_Lessons from Yugoslavia.pdf | 3.1M |
| Castro__Profiles_in_Power_Series_.pdf | 10M |
| Central_and_East_European_Politics__From_Communism_to_Democracy__2nd_Edition.pdf | 6.5M |
| Changing Ethnic Relations in Gambella.pdf | 142K |
| Charting the Roads to Peace.pdf | 800K |
| China's_Foreign_Policy_Debates__Chaillot_Paper_.pdf | 773K |
| China_in_2020__A_New_Type_of_Superpower__Thornton_Center_Chinese_Thinkers_.pdf | 2.8M |
| Christian Attitudes.pdf | 49K |
| Christian Mision, Preselytism and Religious Liberty.pdf | 1.3M |
| Christian_Worldview_Evangelism.pdf | 68K |
| Cities__Nationalism_and_Democratization__Questioning_Cities_.pdf | 2.1M |
| Citizenship, Participation and Accountability.pdf | 444K |
| Citizenship_and_Ethic_Conflict__Challenging_the_Nation_State__Routledge_Research_in_Comparative_Politics_.pdf | 725K |
| Citizenship between De and Re_Ethnicization.pdf | 187K |
| Citizenship in Federalism.pdf | 99K |
| Civil-War_Paul Collier.pdf | 293K |
| Civil Society in Conflict Transformation.pdf | 392K |
| Civil_Military_Dynamics__Democracy__and_International_Conflict__A_New_Quest_for_International_Peace__Advances_in_Foreign_Policy_Analysis_.pdf | 905K |
| Civil_Society__Religion_and_Global_Governance__Paradigms_of_Power_and_Persuasion__Civil_Society__Religion_and_Global_Governance_.pdf | 1.4M |
| Clash_or_Cooperation_of_Civilizations___The_International_Political_Economy_of_New_Regionalisms_Series_.pdf | 2.4M |
| Code Book Conflict Termination 2.1 Dataset.pdf | 112K |
| Codebook UCDP Dyadic_1_2009.pdf | 153K |
| Codebook_UCDP_PRIO Armed Conflict Dataset v4_2009.pdf | 317K |
| Codebook_Uppsala_Conflict_Database_categorical_version,_2009-07-11.pdf | 142K |
| Collection_of_Research.pdf | 671K |
| Collier and Hoeffler (1998), On Economic Causes of Civil War.pdf | 42K |
| Combating Counterfeit Drugs.pdf | 1.1M |
| Communal Federalism in Yugoslavia.pdf | 2.6M |
| Community Oriented Policing Service.pdf | 391K |
| Community POlicing_Singapore.pdf | 80K |
| Community Partnership in Policing.pdf | 74K |
| Community Policing.pdf | 500K |
| Community Policing 21st Century.pdf | 861K |
| Community Policing Beyond the Big Cities.pdf | 258K |
| Community Policing Defined.pdf | 3.5M |
| Community Policing Explained.pdf | 1.2M |
| Community Policing Strategy.pdf | 1.1M |
| Community Policing Through Community Governance.pdf | 1.9M |
| Community Policing_.pdf | 539K |
| Community Policing_A Framework of Understanding.pdf | 365K |
| Community Policing_Defined.pdf | 2.6M |
| Community Policing_Looking to Tomorrow.pdf | 2.0M |
| Community Policing_Taking Stock.pdf | 492K |
| Community Policing_ensuring civilian safety.pdf | 1.9M |
| Community Policing and Community Participation.pdf | 47K |
| Community Policing and Domestic Violence.pdf | 119K |
| Community Policing and Prosecution.pdf | 84K |
| Community Policing and the Justice System.pdf | 5.6M |
| Community Policing for Mayors.pdf | 642K |
| Community Policing in Australia.pdf | 2.9M |
| Community_Oriented_Policing.pdf | 106K |
| Community_Policing.pdf | 298K |
| Community_Policing_.pdf | 2.1M |
| Community_Policing_A_Partnership_in_Action.pdf | 2.0M |
| Community_Policing_Model.pdf | 1.6M |
| Community_Policing in Comparative Perspective.pdf | 508K |
| Comparative Federalism and Decentralization.pdf | 591K |
| Comparative Federalism and Post-statism.pdf | 1.7M |
| Comparative Philosophy.pdf | 3.6M |
| Comparative Politics.pdf | 1.5M |
| Comparative_E_Government__Integrated_Series_in_Information_Systems_25_.pdf | 5.1M |
| Comparative_Government_and_Politics__An_Introduction.pdf | 5.7M |
| Comparative_Political_Systems__Studies_in_the_Politics_of_Pre_Industrial_Societies__Texas_Press_sourcebooks_in_anthropology_.pdf | 41M |
| Comparative_Politics__Domestic_Responses_to_Global_Challenges.pdf | 8.6M |
| Comparative_Politics__Interests__Identities__and_Institutions_in_a_Changing_Global_Order.pdf | 7.3M |
| Comparative_Politics__Rationality__Culture__and_Structure__Cambridge_Studies_in_Comparative_Politics_.pdf | 4.1M |
| Comparative_Politics__The_principal_agent_perspective__Routledge_Research_in_Comparative_Politics_.pdf | 1.4M |
| Complete 2011 WDR Conflict Security and Development.pdf | 10M |
| Comprehensive Approach_Trends_Challenges and Possibilities for Cooperation in Crisis Prevention and Management.pdf | 907K |
| Conducting Conflict Assessment.pdf | 292K |
| Confessions_of_an_Economic_Hit_Man.pdf | 12M |
| Conflict, Social Change and Conflict Resolution.pdf | 360K |
| Conflict-Study-Ethiopia.pdf | 59K |
| Conflict.pdf | 802K |
| Conflict Analysis, Reolution and Politics.pdf | 180K |
| Conflict Analysis.pdf | 802K |
| Conflict Analysis and Response Definition.pdf | 106K |
| Conflict Analysis for Project Planning and Management.pdf | 847K |
| Conflict Formation in Great Lakes Region.pdf | 77K |
| Conflict Prevention.pdf | 131K |
| Conflict Prevention and Peacebuilding Activities.pdf | 2.3M |
| Conflict Prevention and Reconstruction.pdf | 598K |
| Conflict Prognostication.pdf | 691K |
| Conflict Related Development Analysis.pdf | 370K |
| Conflict Resolution_Workshop Facilitators' Guide.pdf | 298K |
| Conflict Resolution_Zartman.pdf | 1.5M |
| Conflict Sensitivity.pdf | 232K |
| Conflict Transformation.pdf | 241K |
| Conflict Transformation and Human Rights_Mutual Stalemate.pdf | 312K |
| Conflict Transformation through State Reform.pdf | 365K |
| Conflict Vulnerability Analysis.pdf | 390K |
| Conflict_Analysis.pdf | 1.0M |
| Conflict_Prevention_and_Peacebuilding_in_Post_War_Societies__sustaining_the_peace.pdf | 1.5M |
| Conflict_and_Reconciliation_in_the_Contemporary_World__Making_of_the_Contemporary_World_.pdf | 736K |
| Conflict and Human Rights Invocations.pdf | 243K |
| Conflict in Somalia.pdf | 654K |
| Consolidating_the_Third_Wave_Democracies__Regional_Challenges__A_Journal_of_Democracy_Book___Volume_2_.pdf | 7.0M |
| Constitution-Making-Handbook.pdf | 1.7M |
| Constitutional_Politics_in_the_Middle_East__With_Special_Reference_to_Turkey__Iraq__Iran_and_Afghanistan__Onati_International_Series_in_Law__amp__Soci.pdf | 865K |
| Constraints in Foreign Policy Decision Making.pdf | 1.1M |
| Construction_of_Governance_States__Routledge_Advances_in_International_Political_Economy_.pdf | 635K |
| Contemporary Peacemaking Conflict Violence and Peace Processes.pdf | 1.0M |
| Contemporary_European_Foreign_Policy.pdf | 799K |
| Contemporary_Peace_Making__Conflict__Violence_and_Peace_Processes.pdf | 1.0M |
| Contemporary_Peacemaking__Conflict__Peace_Processes_and_Post_war_Reconstruction.pdf | 126M |
| Contemporary_Political_Theory A Reader.pdf | 1.4M |
| Contemporary_Political_Theory__A_Reader.pdf | 1.4M |
| Contested_Sudan__The_Political_Economy_of_War_and_Reconstruction__Durham_Modern_Middle_East_and_Islamic_World_Series_.pdf | 1.3M |
| Cooperative Federalism in the 21st Century.pdf | 1.7M |
| Corporate Governance Disclosure.pdf | 255K |
| Corporate_Security_Responsibility___Corporate_Governance_Contributions_to_Peace_and_Security_in_Zones_of_Conflict_.pdf | 802K |
| Corporatism.pdf | 101K |
| Corruption__Development_and_Institutional_Design__International_Economic_Association_Conference_Volume_No__145_.pdf | 1.2M |
| Counting the Public.pdf | 2.0M |
| Courts_under_Constraints__Judges__Generals__and_Presidents_in_Argentina__Cambridge_Studies_in_Comparative_Politics_.pdf | 1.8M |
| Crime Prevention and Community Policing.pdf | 178K |
| Crime of Aggression.pdf | 132K |
| Criminal Notion of Terrorism.pdf | 248K |
| Criteria of Good Governance.pdf | 99K |
| Critical Realism.pdf | 115K |
| Critique on Social Contract.pdf | 704K |
| Crude_Democracy__Natural_Resource_Wealth_and_Political_Regimes__Cambridge_Studies_in_Comparative_Politics_.pdf | 1.6M |
| Cultural Heritageand Law.pdf | 5.2M |
| Culture, Power Asymmeteris and Gender in Conflict Transformation.pdf | 213K |
| Culture_And_Politics__A_Comparative_Approach.pdf | 1.4M |
| Cultures of Politics.pdf | 63M |
| Cybercrime.pdf | 65K |
| DDR_Analysis.pdf | 1.3M |
| DDR_Avoiding Disarmament Failure.pdf | 263K |
| DEVELOPMENT_BEYOND_NEOLIBERALISM___Governance__Poverty_Reduction_and_Political_Economy.pdf | 2.0M |
| DFID CONFLICT ASSESSMENT GUIDANCE NOTE.pdf | 158K |
| DR Congo.pdf | 119K |
| Darfur.pdf | 1.6M |
| DarfurConflict_PeacekeepingChallenges.pdf | 223K |
| Darfur_Dilemmas of a Complex Situation.pdf | 5.8M |
| David Shinn.pdf | 67K |
| Dealing with Diversity.pdf | 759K |
| Debating_Democracy's_Discontent__Essays_on_American_Politics__Law__and_Public_Philosophy.pdf | 3.3M |
| Decentralization Federalism and Conflict.pdf | 65K |
| Decentralization and Prospects for Growth.pdf | 11M |
| Decentralized Governance for Democrcy, Peace....pdf | 1.0M |
| De facto and De jure Recognition.pdf | 501K |
| Defences in ICL.pdf | 175K |
| Definition of Terrorism.pdf | 103K |
| Delegation_and_Accountability_in_Parliamentary_Democracies__Comparative_Politics_.pdf | 4.1M |
| Deliberative_Democracy__Cambridge_Studies_in_the_Theory_of_Democracy_.pdf | 12M |
| Deliberative_Democracy_and_Beyond__Liberals__Critics__Contestations__Oxford_Political_Theory_.pdf | 9.6M |
| Deliberative_Freedom__Deliberative_Democracy_As_Critical_Theory.pdf | 921K |
| Deliberative_Politics__Essays_on_Democracy_and_Disagreement__Practical_and_Professional_Ethics_Series_.pdf | 3.5M |
| Democracy's_Edges__Contemporary_Political_Theory_.pdf | 5.6M |
| Democracy, Conflict and Development.pdf | 84K |
| Democracy, Good Governance and Development.pdf | 324K |
| Democracy, Multinationalism and Federalism.pdf | 152K |
| Democracy.pdf | 1.3M |
| Democracy_Index_2010.pdf | 3.0M |
| Democracy_Transformed___Expanding_Political_Opportunities_in_Advanced_Industrial_Democracies__Comparative_Politics__Oxford_University_Press___.pdf | 1.6M |
| Democracy__039_s_Edge__Choosing_to_Save_Our_Country_by_Bringing_Democracy_to_Life.pdf | 1.8M |
| Democracy__The_God_that_Failed__The_Economics_and_Politics_of_Monarchy__Democracy__and_Natural_Order.pdf | 18M |
| Democracy__and__Democratisation_CL.pdf | 857K |
| Democracy_and_Difference).pdf | 20M |
| Democracy_and_Diversity__Political_Engineering_in_the_Asia___Pacific__Oxford_Studies_in_Democratization_.pdf | 1.4M |
| Democracy_and_Federalism_in_the_European_Union_and_the_United_States__Exploring_Post_National_Governance.pdf | 1.2M |
| Democracy_and_Public_Management_Reform__Building_the_Republican_State.pdf | 1.2M |
| Democracy_and_the_British_American_Relationship.pdf | 1.7M |
| Democracy_and_the_Limits_of_Self_Government__Cambridge_Studies_in_the_Theory_of_Democracy_.pdf | 1.0M |
| Democracy_and_the_News.pdf | 679K |
| Democracy_and_the_Rule_of_Law__Cambridge_Studies_in_the_Theory_of_Democracy_.pdf | 1.8M |
| Democracy_between_Consolidation_and_Crisis__Parties__Groups__and_Citizens_in_Southern_Europe__Oxford_Studies_in_Democratization_.pdf | 1.7M |
| Democracy_from_Above__Regional_Organizations_and_Democratization (1).pdf | 1.8M |
| Democracy_from_Above__Regional_Organizations_and_Democratization.pdf | 1.8M |
| Democracy_in_Divided_Societies__Electoral_Engineering_for_Conflict_Management__Theories_of_Institutional_Design_.pdf | 931K |
| Democracy_in_Latin_America__Political_Change_in_Comparative_Perspective.pdf | 4.8M |
| Democracy_within_Parties__Candidate_Selection_Methods_and_their_Political_Consequences__Comparative_Politics_.pdf | 1.9M |
| Democracy_without_Borders__Transnationalisation_and_Conditionality_in_New_Democracies__Routledge_Ecpr_Studies_in_European_Political_Science__10_.pdf | 2.5M |
| Democratic Dialogue_Handbook.pdf | 3.4M |
| Democratic Transition in Post-Conflict Societies.pdf | 461K |
| Democratic_Accountability_in_Latin_America__Oxford_Studies_in_Democratization_.pdf | 19M |
| Democratic_Challenges__Democratic_Choices__The_Erosion_of_Political_Support_in_Advanced_Industrial_Democracies__Comparative_Politics_.pdf | 1.1M |
| Democratic_Dilemmas__Joint_Work__Education_Politics__and_Community__Suny_Series__School_Districts__Research__Policy__and_Reform_.pdf | 658K |
| Democratic_Policing_in_Transitional_And_Developing_Countries__Interdisciplinary_Research_Series_in_Ethnic__Gender_and_Class_Relations_.pdf | 787K |
| Democratization__A_Critical_Introduction.pdf | 808K |
| Democratization__Theory_and_Experience__Oxford_Studies_in_Democratization_.pdf | 1.7M |
| Democratization__a_comparative_analysis_of_170_countries.pdf | 1.0M |
| Democratization_and_Development__New_Political_Strategies_for_the_Middle_East__Governance__Security_and_Development_.pdf | 926K |
| Democratization_in_Southern_Europe__A_Comparative_Analysis_of_Italy__Spain__and_Turkey__Democratization_Studies_ (1).pdf | 1.4M |
| Democratization_in_Southern_Europe__A_Comparative_Analysis_of_Italy__Spain__and_Turkey__Democratization_Studies_.pdf | 1.4M |
| Democratization_in_the_Middle_East__Experiences__Struggles__Challenges__The_Changing_Nature_of_Democracy_.pdf | 1.1M |
| Democratizing_Communist_Militaries__The_Cases_of_the_Czech_and_Russian_Armed_Forces.pdf | 778K |
| Democratizing a Multi-cultural Society_Merera Gudina.pdf | 133K |
| Dena Freeman.pdf | 1.8M |
| Dentralized there, Centralized Here.pdf | 2.9M |
| Dereje Feyissa - A National Perspective on the Conflict in Gambella.pdf | 66K |
| Designing Tranformation.pdf | 224K |
| Deterring_Democracy.pdf | 2.3M |
| Developing A Comprehensive Framework of Conflict Analysis.pdf | 132K |
| Developing Capacity for Conflict Prevention and Early Response.pdf | 630K |
| Development_and_Democracy__What_Have_We_Learned_and_How___Routledge_Ecpr_Studies_in_European_Political_Science_.pdf | 1.0M |
| Devils_and_Rebels__The_Making_of_Hawthorne__039_s_Damned_Politics.pdf | 1.2M |
| Devolutionary Federalism.pdf | 1.9M |
| Dialectic Inquiry.pdf | 131K |
| Dictatorship To Democracy_Gene Sharp.pdf | 882K |
| Dictionary_Of_The_Israeli___Palestinian_Conflict__Culture__History_And_Politics.pdf | 11M |
| Differentiating the Diaspora.pdf | 244K |
| Digital_Economy__Impacts__Influences_and_Challenges.pdf | 5.1M |
| Dilemmas_of_Pluralist_Democracy__Autonomy_vs__Control__Yale_Studies_in_Political_Science_.pdf | 1.7M |
| Dilemmas of Democratization in Latin America.pdf | 2.5M |
| Diplomacy__Funding_and_Animal_Welfare.pdf | 2.7M |
| Diplomatic Sanctions.pdf | 304K |
| Direct_Democracy__039_s_Impact_on_American_Political_Institutions.pdf | 1.2M |
| Disarmament Glossary.pdf | 669K |
| Diversity and the Social Contract.pdf | 585K |
| Divided and Rule.pdf | 52K |
| Does Fedderlism Constrain the Treaty Power.pdf | 3.1M |
| Does_Peacebuilding_Matterin_Development_Aid.pdf | 266K |
| Doing Quantitive Research in Education With SPSS by Daniel Muijs.pdf | 6.1M |
| Doing_Research_in_Political_Science__An_Introduction_to_Comparative_Methods_and_Statistics.pdf | 1.4M |
| Domingo_the_Crisis_of_International_Law.pdf | 370K |
| Dynamics of Indian Federal System.pdf | 106K |
| EH Carr vs Idealism.pdf | 77K |
| Early Warning and Early Response.pdf | 2.6M |
| Early Warning and Early Response_Handbook.pdf | 385K |
| Early Warning and The Field.pdf | 236K |
| East_Meets_West__Human_Rights_and_Democracy_in_East_Asia.pdf | 1.1M |
| Economic-Consequences-of-War.pdf | 1.4M |
| Economic Causes of Civil Conflict-Implications for Policy.pdf | 286K |
| Economic_Origins_of_Dictatorship_and_Democracy.pdf | 3.6M |
| Economic_Systems_Analysis_and_Policies__Explaining_Global_Differences__Transitions_and_Developments.pdf | 2.9M |
| Education_And_Democracy__The_Meaning_Of_Alexander_Meiklejohn__1872_1964.pdf | 2.2M |
| Effective_Conflict_Analysis_Exercises.pdf | 261K |
| Effects of Small Arms on Human Development.pdf | 482K |
| Elder-Mediation.pdf | 495K |
| Eldership and wisdom in Native conflict processing.pdf | 78K |
| Elections__Parties__Democracy__Conferring_the_Median_Mandate__Comparative_Politics_.pdf | 1.3M |
| Electoral Democracy Numbers FIW 1989-2012--Draft_0.pdf | 17K |
| Electoral_Engineering__Voting_Rules_and_Political_Behavior__Cambridge_Studies_in_Comparative_Politics_ (1).pdf | 2.4M |
| Electoral_Engineering__Voting_Rules_and_Political_Behavior__Cambridge_Studies_in_Comparative_Politics_.pdf | 2.4M |
| Elit and the Quest for Peace_Merera Gudina.pdf | 120K |
| Elusive Peacemakers.pdf | 207K |
| Emperor Menelik_Amharic.pdf | 13M |
| Emperor Twodros_Amharic.pdf | 4.2M |
| Enablig Peace.pdf | 439K |
| Encyclopedia_of_American_Foreign_Policy__Facts_on_File_Library_of_American_History_.pdf | 11M |
| Encyclopedia_of_Democratic_Thought.pdf | 5.0M |
| Encyclopedia_of_Public_Administration_and_Public_Policy__First_Update_Supplement.pdf | 4.0M |
| Enhancing Women's Participation in Electoral Processes.pdf | 119K |
| Enriching Conflict Diagnosis and Startegies for Social Change.pdf | 240K |
| Environment__Scarcity__and_Violence_.pdf | 2.4M |
| Environmental Scarcities and North-South Relations.pdf | 940K |
| Eritrea_The Siege State.pdf | 1.7M |
| Essentials of Research Design and Methodology.pdf | 2.6M |
| Essentials of Social Research.pdf | 11M |
| Ethicity as Cognition.pdf | 219K |
| Ethics_and_Foreign_Policy__LSE_Monographs_in_International_Studies_.pdf | 822K |
| Ethics of foreign policy.pdf | 1.5M |
| Ethnic Conflict Management.pdf | 623K |
| Ethnic Conflict_Territory and Federalism.pdf | 109K |
| Ethnic Federalism in a Dominant Party-State_Lovis Aalen.pdf | 636K |
| Ethnic Identity and Constitutional Design.pdf | 2.5M |
| Ethnic Movements and the Compettion Model.pdf | 2.1M |
| Ethnic Parties and Democratic Stability.pdf | 752K |
| Ethnic Polarization, Potential Conflict and Civil Wars.pdf | 716K |
| Ethnically Dominated Party Systems and the Quality of Democracy.pdf | 302K |
| Ethnic and Religious Conflicts.pdf | 238K |
| Ethnicity and Ethnic Conflict in the Post-Communist-World.pdf | 1.9M |
| Ethnicity and Power in-Ethiopia.pdf | 1.5M |
| Ethno-politics and Globalization.pdf | 105K |
| European_Politics__An_Introduction.pdf | 4.9M |
| Evangelism vs proselytism.pdf | 766K |
| Evolutionary Realism.pdf | 145K |
| Experiences With Impact Assessment.pdf | 180K |
| Explaining_Change_in_Russian_Foreign_Policy__The_Role_of_Ideas_in_post_Soviet_Russia__039_s_Conduct_Towards_the_West__St__Anthony__039_s_Series_.pdf | 893K |
| Exploring a Model of Deethnicization.pdf | 71K |
| Exporting_Security__International_Engagement__Security_Cooperation__and_the_Changing_Face_of_the_U_S__Military.pdf | 1.2M |
| FDRE Constitution.pdf | 306K |
| FDRE_Diplomatic List.pdf | 2.6M |
| Faces of Federalism.pdf | 1.9M |
| Facilitating Humanitarian Assistance.pdf | 401K |
| Facilitation Skill for Interpersonal Transformation.pdf | 207K |
| Facing_Global_Environmental_Change__Environmental__Human__Energy__Food__Health_and_Water_Security_Concepts__Hexagon_Series_on_Human_and_Environmental_.pdf | 92M |
| Failed_States__The_Abuse_of_Power_and_the_Assault_on_Democracy__2006_04.pdf | 78M |
| Famine Crimes in International Law.pdf | 253K |
| Federal_Democracies.pdf | 19M |
| Federalism, Federaitive Systems and Federations.pdf | 2.0M |
| Federalism.pdf | 61K |
| Federalism_Federal Political Systems and Federations_Watts.pdf | 98K |
| Federalism_J_of_Dem Holding Together_Alfred Stefen.pdf | 130K |
| Federalism_J_of_Dem Holding together.pdf | 130K |
| Federalism_Outcomes ande Ideological Preferences.pdf | 2.4M |
| Federalism__Fiscal_Authority__and_Centralization_in_Latin_America__Cambridge_Studies_in_Comparative_Politics_.pdf | 1.4M |
| Federalism_and_Peace_Mediation_FINAL.pdf | 181K |
| Federalism and Consociational Regimes.pdf | 1.6M |
| Federalism and Decentralization.pdf | 1.8M |
| Federalism and Ethnic Conflict Nigeria.pdf | 3.2M |
| Federalism and Freedom.pdf | 1.8M |
| Federalism and Incentives for Sucess of Demicracy.pdf | 128K |
| Federalism and Intrastate Struggle.pdf | 333K |
| Federalism and Party Interaction.pdf | 1.8M |
| Federalism and the Uses and Limits of Law.pdf | 2.2M |
| Federalism at the Crossroads Old Meanings and New Significance.pdf | 2.2M |
| Federalism in a Digital World.pdf | 555K |
| Federalism in the Balkans.pdf | 100K |
| Fifty key thinkers IR 2nd ed.pdf | 2.0M |
| Food_Politics__What_Everyone_Needs_to_Know.pdf | 753K |
| Foreign Policies.pdf | 1.8M |
| Foreign Policy.pdf | 1.8M |
| ForeignPolicyAnalysisDomesticPolitics.pdf | 4.0M |
| Foreign Policy_.pdf | 1.4M |
| Foreign Policy as a Site for Political Action.pdf | 109K |
| Foreign Policy of Japan.pdf | 4.2M |
| Foreign Policy of Pakistan.pdf | 173K |
| Foreign_Aid_and_Foreign_Policy__Lessons_for_the_Next_Half_Century__Transformational_Trends_in_Governance_and_Democracy_.pdf | 2.8M |
| Foreign_Policy_Analysis__A_Comparative_Introduction.pdf | 1.0M |
| Foreign_Policy_Analysis__Continuity_and_Change_in_Its_Second_Generation.pdf | 26M |
| Foreign_Policy_Magazine_2008___September_October.pdf | 14M |
| Foundations of comparative politics.pdf | 4.4M |
| Fractured States.pdf | 1.9M |
| Fragile States.pdf | 1.6M |
| Frameworks and Circles in Peace and Conflict Impact Assessment.pdf | 306K |
| Freedom House Report 2011.pdf | 2.1M |
| Freedom House Report 2012.pdf | 3.5M |
| From Conflict to Peacebuilding.pdf | 1.2M |
| From Constitution and Constitutionalism.pdf | 1.2M |
| From Corporate Responsibility to Good Governance.pdf | 779K |
| From Resolution to Transformation.pdf | 298K |
| From Statism to Federalism_a Pragmatic Shift.pdf | 1.7M |
| Fundamentalism__Sectarianism__and_Revolution__The_Jacobin_Dimension_of_Modernity__Cambridge_Cultural_Social_Studies_.pdf | 759K |
| GTZ_1.pdf | 172K |
| Gambella Conflict.pdf | 75K |
| Gambella_The Anuak.pdf | 211K |
| Gambella_UN Report.pdf | 139K |
| Gambella and Benishangul in Transition.pdf | 512K |
| Gandhi's_Passion__The_Life_and_Legacy_of_Mahatma_Gandhi.pdf | 20M |
| Gatekeepers_of_Growth__The_International_Political_Economy_of_Central_Banking_in_Developing_Countries.pdf | 1.0M |
| GenderPeaceSecurity.pdf | 2.3M |
| Gender Peace and Security.pdf | 2.3M |
| Gender and Conflict Early Warning.pdf | 217K |
| Gender and SSR.pdf | 173K |
| Genocide.pdf | 1.7M |
| Geography and Federalism.pdf | 625K |
| Getachew.pdf | 2.3M |
| Global Income Inequality.pdf | 233K |
| Global Issues.pdf | 831K |
| Global Poverty and Inequality in the 20th Century.pdf | 273K |
| Global Trends 2009.pdf | 3.1M |
| Global_Capitalism__Democracy__and_Civil_Military_Relations_in_Colombia__Suny_Series_in_Global_Politics_.pdf | 8.3M |
| Global_Democracy__For_and_Against__Ethical_Theory__Institutional_Design__and_Social_Struggles__Democratization_Studies_.pdf | 1.0M |
| Global_Politics__Palgrave_Foundations_Series_.pdf | 5.6M |
| Global_Security_Governance__Competing_perceptions_of_Security_in_the_21st_century.pdf | 926K |
| Globalisation, Regionalization and the History of IR.pdf | 639K |
| Globalisation_and_the_Postcolonial_World__The_New_Political_Economy_of_Development__Second_Edition.pdf | 26M |
| Globalization_and_Human_Security.pdf | 2.2M |
| Globalization_and_Terrorism__The_Migration_of_Dreams_and_Nightmares_2nd_Edition.pdf | 649K |
| Globalization and Development_2004.pdf | 2.9M |
| Globalization and Poverty.pdf | 127K |
| Globalization and security.pdf | 1.5M |
| Globalization and the Environment.pdf | 194K |
| Glossary of IR.pdf | 128K |
| Glossary on Migration.pdf | 1.1M |
| Going_Local__Decentralization__Democratization__and_the_Promise_of_Good_Governance.pdf | 2.1M |
| Good Governance, Poverty Reduction and Reform.pdf | 367K |
| Good Governance Practice.pdf | 1.8M |
| Good Governance Standard for Public Services.pdf | 200K |
| Good Governance and Accountability.pdf | 386K |
| Governace Intervention in Post-war Situations.pdf | 153K |
| Governanc-Public Service Delivery.pdf | 931K |
| Governance, International Law and Corporate Social Responsibility.pdf | 693K |
| Governance_and_Politics_in_Post_Military_Nigeria__Changes_and_Challenges.pdf | 1.7M |
| Governance for Sustainable Development.pdf | 242K |
| Government_and_Politics_in_Tribal_Societies.pdf | 25M |
| Grand Extortion_Coup Risk.pdf | 140K |
| Great Lakes Region.pdf | 143K |
| Great_Speeches.pdf | 60M |
| Greed or Grievance.pdf | 159K |
| Greek philosophers as theologians.pdf | 1.0M |
| Group Rights as Human Rights A Liberal Approach to Multiculturalism.pdf | 1.3M |
| Group_Rights_as_Human_Rights__A_Liberal_Approach_to_Multiculturalism__Law_and_Philosophy_Library_.pdf | 1.3M |
| Group versus Individual Rights.pdf | 380K |
| Habermas_Religious%20Tolerance.pdf | 85K |
| Hamas.pdf | 2.2M |
| Hamas and the Peace Process.pdf | 1.7M |
| Hammas' Response to Oslo.pdf | 2.3M |
| Handbook Political Theory.pdf | 5.1M |
| Handbook_of_Conflict_Analysis_and_Resolution.pdf | 2.3M |
| Handbook_of_Global_International_Policy__Public_Administration_and_Public_Policy_.pdf | 2.7M |
| Handbook_of_Political_Methodology__Oxford_Handbooks_of_Political_Science_.pdf | 48M |
| Hand book for Sustainable Peace.pdf | 2.4M |
| Handbook of Comparative Politics.pdf | 69K |
| Handbook of Conflict Analysis and Resolution.pdf | 2.3M |
| Handbook of Peace and Conflict Studies.pdf | 2.6M |
| Handbook of Political Methodology.pdf | 48M |
| Handbook of Public Policy.pdf | 4.2M |
| Handbook on Peacebuilding.pdf | 2.0M |
| Handbook on fighting corruption.pdf | 416K |
| Hawks and Doves.pdf | 395K |
| Hermann-Foreign Policy Research.pdf | 972K |
| Historical Realism.pdf | 1.3M |
| How Democracies Emerge_the Sequence Fallacy.pdf | 243K |
| How_Democratic_Is_the_American_Constitution_.pdf | 932K |
| How_International_Relations_Affect_Civil_Conflict__Cheap_Signals__Costly_Consequences__Innovations_in_the_Study_of_World_Politics.pdf | 1.4M |
| Human Rights Guidance Notes.pdf | 319K |
| Human Rights_Looking Back to the Future.pdf | 80K |
| Human Security.pdf | 1.4M |
| Human Security Approaches_and_Challenges.pdf | 2.3M |
| Human Security Report 2009.pdf | 4.2M |
| Human_Rights_Humanitarian_Action.pdf | 86K |
| Human_Rights_and_Comparative_Foreign_Policy.pdf | 1.7M |
| Human_Rights_and_US_Foreign_Policy__Routledge_Research_in_Human_Rights_.pdf | 944K |
| Human_Rights_in_Chinese_Foreign_Relations__Defining_and_Defending_National_Interests.pdf | 855K |
| Human_Rights_in_the___039_War_on_Terror__039_.pdf | 3.5M |
| Human_Security_Concept_and_Measurement.pdf | 151K |
| Human_Security__Approaches_and_Challenges.pdf | 2.3M |
| Humanitarian Intervention, NATO and International Law.pdf | 278K |
| Hurting Stalemate.pdf | 644K |
| IGAD_Conflict Early Warning Mechanism.pdf | 509K |
| IHL and Humanitarian action.pdf | 223K |
| IHL and the Geneva Convention.pdf | 1.2M |
| ILPI-Report_Islamism-in-the-Horn-of-Africa.pdf | 2.9M |
| IL for IR Studies.pdf | 153K |
| IL of Environmental Impact Assessment.pdf | 1.5M |
| IR-1.pdf | 1.0M |
| IR-2.pdf | 1.1M |
| IR-3.pdf | 3.9M |
| IR-4.pdf | 1.8M |
| IR Theory.pdf | 1.7M |
| IR_A Network Approach.pdf | 383K |
| IR and Realism.pdf | 276K |
| Idealism Revisited.pdf | 197K |
| Identity__Interest__and_Ideology__An_Introduction_to_Politics.pdf | 12M |
| Identity_and_Foreign_Policy.pdf | 2.7M |
| Imitation_in_International_Relations__Observational_Learning__Analogies_and_Foreign_Policy_in_Russia_and_Ukraine.pdf | 1.5M |
| Implementing Community Policing.pdf | 270K |
| Implications of Wourldwide Population Growth.pdf | 462K |
| Improving Ethnic Conflict Analysis.pdf | 218K |
| In Larger Freedom_K Annan.pdf | 274K |
| Incomplete_Democracy__Political_Democratization_in_Chile_and_Latin_America__Latin_America_in_Translation_En_Traduccion_Em_Traducao_.pdf | 540K |
| Indian Federal System.pdf | 77K |
| Indigenous Oromo Conflict Management.pdf | 255K |
| Indigenous System of CR Oromiya.pdf | 130K |
| Informal Institutions and Comparative Politics.pdf | 242K |
| Institutional Tools of Conflict Management.pdf | 210K |
| Institutions_and_Democratic_Citizenship__Oxford_Studies_in_Democratization_.pdf | 1.1M |
| Institutions and Development.pdf | 339K |
| Integrating Gender in SSR.pdf | 173K |
| Integrating Levels of Analses.pdf | 183K |
| Integrating Peacebuilding.pdf | 1.0M |
| Internal Displacement.pdf | 2.0M |
| Internal Displacement and Domestic Law.pdf | 763K |
| International Conflict Mediation.pdf | 51K |
| International Guide to NGO Activities_Post-Conflict.pdf | 457K |
| International Law.pdf | 634K |
| International Law_and_Peace.pdf | 113K |
| International Law and Humanitarian Assistance.pdf | 714K |
| International Organizations .....pdf | 93K |
| International Organizations.pdf | 2.3M |
| International Peremptory Norms.pdf | 418K |
| International Relations_Holsti.pdf | 174K |
| International Relations theories in the 21st C.pdf | 1.1M |
| International Trade Law.pdf | 224K |
| International Tribunals.pdf | 102K |
| International_Democracy_and_the_West__The_Role_of_Governments__Civil_Society__and_Multinational_Business__Oxford_Studies_in_Democratization_ (1).pdf | 1.4M |
| International_Democracy_and_the_West__The_Role_of_Governments__Civil_Society__and_Multinational_Business__Oxford_Studies_in_Democratization_ (2).pdf | 1.4M |
| International_Relations__The_Key_Concepts___2nd_Edition__Routledge_Key_Guides_.pdf | 1.8M |
| Interregionalism_and_International_Relations__A_Stepping_Stone_to_Global_Governance___Routledge_Advances_in_International_Relations_and_Global_Politic.pdf | 1.3M |
| Interview With Bereket Simon httpwww.pulitzercenter.orgtempBereket_07.pdf | 77K |
| Intifada_The Second.pdf | 118K |
| Intolerance_against_Christians_in_Europe_-_online_version.pdf | 346K |
| Intolerance and Discrimination.pdf | 90K |
| Intro-Peace,_conflict,_development_and_security.pdf | 292K |
| Introduction to conflict resolution.pdf | 385K |
![[DOC]](/icons/quill.png) | Intro to PM.ppt | 330K |
| Iran's_Foreign_Policy_in_the_Post_Soviet_Era__Resisting_the_New_International_Order.pdf | 1.4M |
| Iran_and_the_Rise_of_its_Neoconservatives__The_Politics_of_Tehran__039_s_Silent_Revolution.pdf | 866K |
| Isalm.pdf | 18M |
| Islam, the Orthodox Church and Oromo Nationalism.pdf | 215K |
| Islam_Orthodox and Ormo Nationalism.pdf | 775K |
| Islamic Peacemaking Since 9-11.pdf | 620K |
| Israel-Palestine_Limits of Pragmatism.pdf | 1.8M |
| Israel and Palestine.pdf | 414K |
| Israel and Palestine Intractible Conflict.pdf | 203K |
| Israel and Palestine_Conflicting Peace Proposals.pdf | 2.6M |
| Israel and Palestine_Ome State Solution.pdf | 1.4M |
| Israel and Palestine_the Geneva Proposal.pdf | 237K |
| Israeli-Palestinian Peace Process_1993-2000.pdf | 2.5M |
| Israeli.pdf | 612K |
| Israeli Leadership.pdf | 2.1M |
| Israeli Occupation.pdf | 282K |
| Israeli Security Doctrine.pdf | 194K |
| Israeli_Palestinian.pdf | 2.9M |
| Israelia-Palestinian Conflict_Mediation.pdf | 2.7M |
| Issues_and_Methods_in_Comparative_Politics__An_Introduction.pdf | 11M |
| Issues_and_Methods_in_Comparative_Politics__An_Introduction__3rd_edition.pdf | 2.4M |
| Issues and Debates inTransitional Rule.pdf | 4.2M |
| Issues of Federalism in Response to Terrorism.pdf | 472K |
| JICA-RI_WP_No.22_2010.pdf | 475K |
| Jacques_Derrida__Routledge_Critical_Thinkers_.pdf | 653K |
| Jews By Nature.pdf | 98K |
| Jihad_From Quran to Bin Laden.pdf | 2.5M |
| Jihad__From_Qu__039_ran_to_Bin_Laden.pdf | 2.5M |
| Jimma.pdf | 104K |
| Khawarij and Jihaad.pdf | 763K |
| Khedive_Ismail's_Army__Cass_Military_Studies_.pdf | 1.4M |
| Kosovo Crises and International Law.pdf | 911K |
| Labratories of Democracy.pdf | 1.2M |
| Law Roots.pdf | 13M |
| Law on Non-International Armed Conflict.pdf | 342K |
| Legal Definition of International Law.pdf | 128K |
| Legal responsibilities of IOs.pdf | 302K |
| Liberalism.pdf | 1.0M |
| Liberia_uneven process in SSR.pdf | 2.4M |
| Limits of Economic Sanctions.pdf | 258K |
| Linking_Citizens_and_Parties__How_Electoral_Systems_Matter_for_Political_Representation__Comparative_Politics_.pdf | 949K |
| List of Logical Fallacies.pdf | 181K |
| List of Peacekeeping Operations.pdf | 797K |
| Local Government Dicretion and Accountability.pdf | 4.4M |
| Locke and Russeau.pdf | 104K |
| Lockstep Analysis and the Concept of Federalism.pdf | 1.1M |
| Majorities and Minorities_A Comparatice Survey of Ethnic Violence.pdf | 1.4M |
| Making Globalization Work.pdf | 2.9M |
| Making_and_Breaking_Democratic_Transitions__The_Comparative_Politics_of_Russia__039_s_Regions.pdf | 20M |
| Markets_Politics and Globalization.pdf | 118K |
| Marxism and Dialectic Method.pdf | 215K |
| Max Weber's Conception of the State.pdf | 2.4M |
| Me_Against_My_Brother___At_War_in_Somalia__Sudan_and_Rwanda.pdf | 2.9M |
| Media_Reform__Democratizing_the_Media__Democratizing_the_State__Routledge_Research_in_Cultural_and_Media_Studies_.pdf | 895K |
| Media__Wars_and_Politics.pdf | 622K |
| Medrek_Political Program.pdf | 541K |
| Mengistu HMariam's Book.pdf | 31M |
| Merera on Oromos Self and Shared Rule.pdf | 471K |
| Military Expenditure_Threats and Growth.pdf | 178K |
| Military Intervention in Sierra Leon.pdf | 1.6M |
| Military Spending and Risks Coups.pdf | 178K |
| Minority Rights and Conflict Prevention.pdf | 436K |
| Mitigating Ethnic Conflict in Plural Societies.pdf | 1.9M |
| Mobile Techology for Conflict Management.pdf | 3.6M |
| Mobilizing Public Opinion for Peace.pdf | 244K |
| Modern Theories of Ethnicity.pdf | 412K |
| Moral_Movements_and_Foreign_Policy__Cambridge_Studies_in_International_Relations_.pdf | 1.1M |
| Morgenthau's Unrealistic Realism.pdf | 247K |
![[TXT]](/icons/text.png) | Morgenthau's Unrealistic Realism.txt | 42K |
| Multilateral Trade Liberalization and Developing Countries.pdf | 333K |
| Muslim Oromo in Jimma.pdf | 2.4M |
| Muslim Rights Movt Dereje Feyisa.pdf | 395K |
| NEPAD.pdf | 202K |
| National Interest.pdf | 88K |
| National Intrest.pdf | 1.1M |
| Nationalism_Ethic Conflict and Rationality.pdf | 2.9M |
| Nationalism_in_International_Relations__Norms__Foreign_Policy__and_Enmity__Advances_in_Foreign_Policy_Analysis_.pdf | 904K |
| Nations and Nation Building.pdf | 205K |
| Negotiation_and_Conflict_Management__Essays_on_Theory_and_Practice___Security_and_Conflict_Management_ (2).pdf | 1.2M |
| Negotiation_and_Conflict_Management__Essays_on_Theory_and_Practice___Security_and_Conflict_Management_.pdf | 1.2M |
| Negotiation and Conflict Management.pdf | 1.2M |
| Neighbors at Risk.pdf | 1.0M |
| Nelson_Mandela__A_Biography__Greenwood_Biographies_.pdf | 694K |
| New Approaches to International Legal Personalities.pdf | 224K |
| New Frontiers in Transparency.pdf | 1.1M |
| New Trends in Peace and Conflict Impact Assessment.pdf | 217K |
| New_Sources_of_Development_Finance__UNU_WIDER_Studies_in_Development_Economics_.pdf | 1.7M |
| Nile Politics.pdf | 298K |
| Non-Separatist Policies Regarding Ethnic Minoritiess.pdf | 494K |
| Non-violent Conflict Management.pdf | 1.0M |
| Nongovernmental_Organizations_in_International_Society__Struggles_over_Recognition.pdf | 919K |
| Nonviolent Resistance and Conflict Transformation.pdf | 300K |
| Norm Conflict in International Law.pdf | 188K |
| North-South FTAs.pdf | 463K |
| North-South Relations.pdf | 475K |
| North-South Relations and Global Governance.pdf | 181K |
| North-South Trade.pdf | 196K |
| OLF and TPLF_Outcomes of Negotiations.pdf | 214K |
| OPC_Political Program.pdf | 112K |
| Observing_International_Relations__Niklas_Luhmann_and_world_politics.pdf | 2.1M |
| Office of the President (proclamation).pdf | 312K |
| Office of the President (proclamation).txt | 13K |
| Ogaden_Collective Punishment_War Crimes and Crime Against Humanity.pdf | 1.4M |
| Oil__Politics_and_Violence__Nigeria__039_s_Military_Coup_Culture_1966_1976.pdf | 2.7M |
| On_Political_Equality.pdf | 370K |
| Openness_and_Foreign_Policy_Reform_in_Communist_States.pdf | 1.4M |
| Operational Conflict Prevention.pdf | 151K |
| Opportunities for Synergy.pdf | 283K |
| Oppositional_Discourses_and_Democracies__Routledge_Studies_in_Social_and_Political_Thought_.pdf | 2.0M |
| Oromo Studies Association_Newsletter_No.2.pdf | 154K |
| Orwell-1984.pdf | 1.5M |
| Orwell Animal Farm.pdf | 213K |
| Ottoman_Diplomacy__Conventional_or_Unconventional___Studies_in_Diplomacy_.pdf | 1.3M |
| Palestien and Israel_After Arafat.pdf | 217K |
| Palestine Divided.pdf | 246K |
| Palestine_Israel_Bringing the Gap.pdf | 648K |
| Palestine and Israel.pdf | 1.3M |
| Palestine and Israel_Camp DAvid Negotiation.pdf | 2.9M |
| Palestine and Israel_Fair Division.pdf | 619K |
| Palestine and Israel_Relgion, State,,,,.pdf | 601K |
| Palestine and Israel_The Oslo Accord.pdf | 1.3M |
| Palestine question.pdf | 1.3M |
| Palestinian Refugees.pdf | 325K |
| Parliamentary_Party_Groups_in_European_Democracies___Political_Parties_Behind_Closed_Doors__Hardcover___Routledge_Ecpr_Studies_in_European_Political_S.pdf | 3.0M |
| Participatory Action-research in Post-conflict Situation.pdf | 614K |
| Partiipatory Ecaluation and Critical Peace Research.pdf | 233K |
| Partisan_Politics_in_the_Global_Economy__Cambridge_Studies_in_Comparative_Politics_.pdf | 6.0M |
| Party_Competition_between_Unequals__Strategies_and_Electoral_Fortunes_in_Western_Europe__Cambridge_Studies_in_Comparative_Politics_.pdf | 2.1M |
| Party_Elites_In_Divided_Societies__Political_Parties_in_Consociational_Democracy__Routledge_Ecpr_Studies_in_European_Political_Science__7_.pdf | 3.1M |
| Peace Education.pdf | 403K |
| Peace Education_TWB.pdf | 18M |
| Peace Initiatives and Public Opinion.pdf | 3.6M |
| Peace Research Capacity Building.pdf | 813K |
| Peace_and_International_Relations__A_New_Agenda__Routledge_Studies_in_Peace_and_Conflict_Resolution_.pdf | 1.0M |
| Peace_as_Governance__Power_Sharing__Armed_Groups_and_Contemporary Peace Negotiations Rethinking Peace and Conflict Studies.pdf | 672K |
| Peace_as_Governance__Power_Sharing__Armed_Groups_and_Contemporary_Peace_Negotiations__Rethinking_Peace_and_Conflict_Studies_.pdf | 672K |
| Peace and Conflict Europe and Beyond.pdf | 913K |
| Peace and Conflict Impact Assessment Methodology.pdf | 227K |
| Peace and Security in the Post-modern World.pdf | 1.2M |
| Peacebuilding Commission.pdf | 565K |
| Peacebuilding_A Community Based Approach.pdf | 329K |
| Peacebuilding_Caritas Manual.pdf | 1.9M |
| Peacebuilding at the Crossroads.pdf | 1.0M |
| Peacebuilding in Development.pdf | 575K |
| Peace by Proxy.pdf | 184K |
| Peacekeeping Operations in DRC_Perception of the Population.pdf | 1.8M |
| Peacekeeping in Sudan.pdf | 2.4M |
| Peacemakers_in_Action__Profiles_of_Religion_in_Conflict_Resolution.pdf | 2.3M |
| Peacemaking and Peacebuilding.pdf | 311K |
| Peace with Justice.pdf | 251K |
| Performance__Critical_Concepts_in_Literary_and_Cultural_Studies_Vol__III.pdf | 69M |
| Piracy_a legal defintion.pdf | 155K |
| Playing_by_the_Rule.pdf | 428K |
| Political-Parties-in-Conflict-Prone-Situations.pdf | 1.8M |
| Political-Parties-in-Conflict-Prone-Societies.pdf | 1.8M |
| Political Concepts.pdf | 1.9M |
| Political Culture in Ethniopia.pdf | 267K |
| Political Realism in Germany.pdf | 343K |
| Political Safeguards of Federalism.pdf | 1.8M |
| Political Violence and Uncertainy.pdf | 284K |
| Political_Communication_in_Postmodern_Democracy__Challenging_the_Primacy_of_Politics.pdf | 942K |
| Political_Competition__Partisanship__and_Policy_Making_in_Latin_American_Public_Utilities__Cambridge_Studies_in_Comparative_Politics_.pdf | 2.7M |
| Political_Dissent_in_Democratic_Athens__Intellectual_Critics_of_Popular_Rule_.pdf | 1.1M |
| Political_Finance_Systems_in_Egypt.pdf | 204K |
| Political_Parties__Old_Concepts_and_New_Challenges__Comparative_Politics_.pdf | 2.7M |
| Political_Parties_and_Terrorist_Groups_2nd_ed___Extremism_and_Democracy_.pdf | 1.2M |
| Political_Parties_in_Advanced_Industrial_Democracies__Comparative_Politics_.pdf | 2.0M |
| Political_Parties_in_Post_Communist_Eastern_Europe.pdf | 3.5M |
| Political_Party_Aid.pdf | 179K |
| Political_Reconciliation__Routledge_Innovations_in_Political_Theory_.pdf | 1.0M |
| Political_transformations_and_political_entrepreneurs__Israel_in_comparative_perspective.pdf | 1.4M |
| Politicising_Democracy__The_New_Local_Politics_of_Democratisation__International_Political_Economy_Series_.pdf | 965K |
| Politics_of_Confrontation__The_Foreign_Policy_of_the_USA_and_Revolutionary_Iran__Library_of_International_Relations_.pdf | 1.5M |
| Politics of conflict Resolution.pdf | 1.8M |
| Popular Authorship and Constitution Making- Comparing and Contras.pdf | 1.8M |
| Popular Involvement Constitution Making.pdf | 135K |
| Popular_Movements_and_Democratization_in_the_Islamic_World__New_Horizons_in_Islamic_Studies_.pdf | 1.3M |
| Post-Conflict Recovery.pdf | 268K |
| Post-Conflict Risks.pdf | 274K |
| Post-conflict-peace-building-constitution-making-chicago-journal-international-law.pdf | 185K |
| Post_Communist_Democratization__Political_Discourses_Across_Thirteen_Countries__Theories_of_Institutional_Design_.pdf | 1.2M |
| Post_communist_Regime_Change__A_Comparative_study__Routledge_Research_in_Comparative_Politics_.pdf | 1.1M |
| Post_conflict_Administrations_in_International_Law.pdf | 1.6M |
| Poverty__Participation__and_Democracy__A_Global_Perspective.pdf | 1.3M |
| Poverty and Democracy_Larry Diamond.pdf | 85K |
| Powers_and_Prospects__Reflections_on_human_nature_and_the_social_order.pdf | 1.2M |
| Powers of Persuation.pdf | 3.8M |
| Practical_Management_of_the_Side_Effects_of_Psychotropic_Drugs.pdf | 4.4M |
| Presidential_Impeachment_and_the_New_Political_Instability_in_Latin_America__Cambridge_Studies_in_Comparative_Politics_.pdf | 1.7M |
| Presidential_Risk_Behavior_in_Foreign_Policy__Prudence_or_Peril_.pdf | 1.0M |
| Presidentialism-Multipary .....pdf | 89K |
| Presidentialism__Parliamentarism__and_Democracy__Cambridge_Studies_in_Comparative_Politics_.pdf | 2.1M |
| Preventing Genocide.pdf | 1.9M |
| Preventing Violence, War and State Collapse.pdf | 3.5M |
| Primordialism.pdf | 184K |
| Principles of Corporate Governance.pdf | 494K |
| Prioritizing_Protection_from_Mass_Atrocities.pdf | 1.5M |
| Private Military and Security Companies in Humanitarian Interventions.pdf | 191K |
| Problems and Options in Institutionalizing Ethnic Relations.pdf | 472K |
| Problems of revolutionary democracy.pdf | 276K |
| Promoting Institutional Developement.pdf | 473K |
| Promoting Justice, Human Rights and Conflict Resolution.pdf | 3.3M |
| Promoting Social Integration.pdf | 188K |
| Promoting Social Reconciliation.pdf | 233K |
| Promoting_justice__human_rights_and_conflict_resolution_through_international_law__liber_amicorum_Lucius_Caflisch.pdf | 3.3M |
| Pros and Cons of Federal Systems.pdf | 79K |
| Proselytism Games and Humanitarian Aid.pdf | 153K |
| Prospects_of_Democracy__A_Study_of_172_Countries.pdf | 2.6M |
| Protecting Civilians in the Context of UN Peacekeeping Operations.pdf | 3.0M |
| Protection of Human Rights in Armed Conflict.pdf | 911K |
| Proxy War in Somalia.pdf | 754K |
| Psychology_of_Liberation__Theory_and_Applications__Peace_Psychology_Book_Series_.pdf | 1.4M |
| Public-Sector-Transparency.pdf | 1.2M |
| Public Interest Rules.pdf | 4.7M |
| Public Opinion and Foreign Policy.pdf | 2.0M |
| Public involvement in Community Policing.pdf | 290K |
| Qualitative Research.pdf | 126K |
| Qualitative Research in Practice.pdf | 778K |
| Racial and Religious Tolerance.pdf | 60K |
| Raising Rebels.pdf | 949K |
| Rationalizing_Capitalist_Democracy__The_Cold_War_Origins_of_Rational_Choice_Liberalism.pdf | 4.4M |
| Re-reading Rousseau.pdf | 238K |
| Re-reading of the Dialectic Method.pdf | 835K |
| Realism, Security and Democracy.pdf | 72K |
| Realism and Lberalism_Third_Pass.pdf | 111K |
| Realism in the Study of World POlitics.pdf | 2.3M |
| Reappraising The Greed and Grievance Explanation of Conflicts.pdf | 166K |
| Reassessment of Federalism.pdf | 1.9M |
| Recent Developments of Swiss Federalim.pdf | 3.1M |
| Reciprocity in IL.pdf | 243K |
| Reconciling Rights and Federalism.pdf | 735K |
| Recovering from Violent Conflict.pdf | 271K |
| Redistribution.pdf | 665K |
| Redistricting_in_Comparative_Perspective__Comparative_Politics_.pdf | 1.2M |
| Regime, Institution and Foreign Policy.pdf | 739K |
| Regime_Building__Democratization_and_International_Administration__Oxford_Studies_in_Democratization_.pdf | 1.6M |
| Regional Coordination for Reduced Military Spending.pdf | 435K |
| Regional Organizations' Capacities for Conflict Resolution.pdf | 1.0M |
| Regional Security Diensions.pdf | 294K |
| Regional_Cooperation_in_the_Great_Lakes_region.pdf | 397K |
| Regional_Trade_Integration_and_Conflict_Resolution__Southern_Perspectives__Routledge_Advances_in_International_Political_Economy_.pdf | 1.5M |
| Religion-Conflict-Africa_100819.pdf | 209K |
| Religion.pdf | 3.6M |
| Religion__Class_Coalitions__and_Welfare_States__Cambridge_Studies_in_Social_Theory__Religion_and_Politics_.pdf | 1.2M |
| Religion and Law.pdf | 168K |
| Religion and Politics.pdf | 141K |
| Religious Contributions to Peace.pdf | 1.3M |
| Religious Contributions to Peacemaking.pdf | 1.3M |
| Religious Extremism.pdf | 251K |
| Religious Origins of Religious Tolerance.pdf | 905K |
| Religious Thought.pdf | 245K |
| Religious Tolerance.pdf | 1.3M |
| Religious Tolerance among Orthodox and Muslims.pdf | 146K |
| Religious_freedom.pdf | 755K |
| Resisting_Rebellion__The_History_And_Politics_Of_Counterinsurgency.pdf | 1.0M |
| Resolution 242.pdf | 884K |
| Resort_to_War__A_Data_Guide_to_Inter_State__Extra_State__Intra_State__and_Non_State_Wars__1816___2007__Correlates_of_War_Series_ (2).pdf | 4.9M |
| Resort_to_War__A_Data_Guide_to_Inter_State__Extra_State__Intra_State__and_Non_State_Wars__1816___2007__Correlates_of_War_Series_.pdf | 4.9M |
| Restorative Justice.pdf | 102K |
| Rethinking Conflict Transformation from Human Rights Perspective.pdf | 358K |
| Rethinking Federalism.pdf | 551K |
| Rethinking Reconciliation.pdf | 1.0M |
| Rethinking_Arab_Democratization__Elections_without_Democracy__Oxford_Studies_in_Democratization_.pdf | 3.3M |
| Revisiting Change and Conflict.pdf | 199K |
| Revisiting the Greed and Grievance Explanation.pdf | 175K |
| Revolution_and_Foreign_Policy__The_Case_of_South_Yemen__1967_1987__Cambridge_Middle_East_Library_.pdf | 9.6M |
| Revolution_in_the_Arab_World__Tunisia__Egypt__And_the_Unmaking_of_an_Era.pdf | 1.0M |
| Rewriting_History.pdf | 2.3M |
| Rhetoric and Reality in North-South Relations.pdf | 551K |
| Right to Secession_Theory and History.pdf | 272K |
| Ripeness Theory.pdf | 740K |
| Ripeness for International Mediation.pdf | 806K |
| Rourke_Levels of Analysis.pdf | 1.3M |
| Rousseau_Social Contract.pdf | 426K |
| Rousseau and the Revolution.pdf | 549K |
| Routledge History of Philosophy - British Empiricism and the Enlightenment - Volume 5.pdf | 2.2M |
| Routledge History of Philosophy - From Aristotle to Augustine - Volume 2.pdf | 3.0M |
| Routledge History of Philosophy - From the Beginning to Plato - Volume 1.pdf | 2.4M |
| Routledge History of Philosophy - Medieval Philosophy - Volume 3.pdf | 2.6M |
| Routledge History of Philosophy - Philosophy of Meaning, Knowledge and Value in the Twentieth Century - Volume 10.pdf | 2.0M |
| Routledge History of Philosophy - Philosophy of Science, Logic and Mathematics in the Twentieth Century - Volume 9.pdf | 4.2M |
| Routledge History of Philosophy - The Age of German Idealism - Volume 6.pdf | 1.9M |
| Routledge History of Philosophy - The Nineteenth Century - Volume 7.pdf | 2.1M |
| Routledge History of Philosophy - The Renaissance and Seventeenth Century Rationalism - Volume 4.pdf | 2.4M |
| Routledge History of Philosophy - Twentieth-Century Continental Philosophy - Volume 8.pdf | 2.6M |
| Rules of International Law.pdf | 4.7M |
| Russian_Foreign_Policy__The_Return_of_Great_Power_Politics__Council_on_Foreign_Relations_Books__Rowman__amp__Littlefield__.pdf | 4.1M |
| Russian_Foreign_Policy_and_the_CIS__Routledge_Advances_in_International_Relations_and_Politics__24_.pdf | 747K |
| Rwanda_Ten Years After Genocide.pdf | 158K |
| SSR.pdf | 628K |
| SSR_CAR.pdf | 971K |
| SSR_Challenges and Opportunities in Post Conflict Liberia.pdf | 625K |
| SSR_Potentials and Challenges for Conflict Transformation.pdf | 898K |
| SSR_Public Private Priorities.pdf | 659K |
| SSR_Securing the Future.pdf | 308K |
| SSR and UN Integrated Missions.pdf | 855K |
| Secrecy_in_US_Foreign_Policy.pdf | 1.6M |
| Securing Development.pdf | 699K |
| Securing_Democracy__Political_Parties_and_Democratic_Consolidation_in_Southern_Europe.pdf | 962K |
| Selected Sources of International Law.pdf | 700K |
| Selected_Works_of_Michael_Wallerstein__The_Political_Economy_of_Inequality__Unions__and_Social_Democracy__Cambridge_Studies_in_Comparative_Politics_.pdf | 2.4M |
| Self-Governance and Conflict Rsolution.pdf | 1.9M |
| Self-enforcing Federlaim.pdf | 278K |
| Self_Defense_in_International_Relations.pdf | 803K |
| Service.pdf | 1.3M |
| Sinke.pdf | 611K |
| Sinke of the Oromo.pdf | 611K |
| Small Arms Trade.pdf | 723K |
| Small Nation.pdf | 2.4M |
| Small_States_in_Global_Affairs__The_Foreign_Policies_of_the_Caribbean_Community__CARICOM___Studies_of_the_Americas_.pdf | 1.0M |
| Social Cohesion.pdf | 163K |
| Social Contract - Idea of Sovereignty - Rousseau.pdf | 1.1M |
| Social Contract Books I and II.pdf | 870K |
| Social Contract_The Evolution.pdf | 129K |
| Social Exclusion.pdf | 98K |
| Social Exclusion and Social Solidarity_Three Paradigms.pdf | 2.8M |
| Social Exculsion_Social Isolation and Distribution of Income.pdf | 76K |
| Social _contract.pdf | 390K |
| Social contrat_Old and New.pdf | 96K |
| Somali Region Assessment.pdf | 523K |
| South Sudan_SSR.pdf | 432K |
| Sovereignty and Autonomy under Federalism.pdf | 2.0M |
| Sovereignty in IL.pdf | 1.1M |
| Soviet Federalism and Ethnic Mobilization.pdf | 3.5M |
| Sowing_Crisis__The_Cold_War_and_American_Dominance_in_the_Middle_East.pdf | 3.1M |
| Speak_Peace_in_a_World_of_Conflict__What_You_Say_Next_Will_Change_Your_World.pdf | 1.0M |
| Stalin_Dialectical and Historical Materialism.pdf | 210K |
| State Formation in the Context of Fragility.pdf | 247K |
| State Responsiveness to Public Security Needs.pdf | 402K |
| State Sponsored Assassinations and International Law.pdf | 212K |
| Statebuilding for Future Wars.pdf | 520K |
| States_and_Social_Revolutions__A_Comparative_Analysis_of_France__Russia_and_China_2.pdf | 18M |
| Statistics__A_Tool_for_Social_Research__Eighth_Edition_ (1).pdf | 2.4M |
| Strategy in Conflict Analysis.pdf | 2.4M |
| Strenghtening NMCCT.pdf | 216K |
| Structural Realism after the Cold War.pdf | 269K |
| Structural and Direct Violence_Galtung.pdf | 267K |
| Structure and Process in Federalism.pdf | 833K |
| Studies on the Social Contract.pdf | 396K |
| Sudan's Remaining Conflicts.pdf | 110K |
| Sudan_the Crisis in Darfur.pdf | 179K |
| Supporting Justice, Coexistence and Reconciliation after Armed Conflict.pdf | 225K |
| Supporting Post-conflict Reconciliation.pdf | 429K |
| Sustainable Development Indicators.pdf | 1.0M |
| System_Effects.pdf | 880K |
| TCRM in Oromiya.pdf | 255K |
| THE LASTING STRUGGLE FOR FREEDOM IN ERITREA.pdf | 1.5M |
| TManual.pdf | 1.3M |
| TOT_Manual.pdf | 1.5M |
| TPLF_A Political History.pdf | 2.1M |
| Targeted Sanctions and Due Process.pdf | 420K |
| Targeting the Unarmed.pdf | 970K |
| Tauyz.pdf | 936K |
| Te Art of Argument.pdf | 1.7M |
| Team and Organizational Development as a Means of Conflict Prevention.pdf | 415K |
| Terrorism, Counterterrorism and Torture.pdf | 608K |
| Tesfaye Gebre Ab_Yederasiw Mastawesha.pdf | 81M |
| Thabo_Mbeki_and_the_Battle_for_the_Soul_of_the_ANC__Second_Edition.pdf | 2.9M |
| The AU-UN Hybrid Operation in Darfur.pdf | 145K |
| The Causes of Politicization of Ethnicity.pdf | 377K |
| The Challenge of Critical Theories.pdf | 93K |
| The Challenge of War Economies.pdf | 213K |
| The Circularity of Conflict Dynamics.pdf | 189K |
| The Creation of Eritrea_Colonial Documents.pdf | 1.9M |
| The Creation of States in International Law.pdf | 403K |
| The Definition of Responsibility in International Law.pdf | 1.5M |
| The Demand For Military Expenditure.pdf | 68K |
| The EPRDF.pdf | 373K |
| The EU's Collective Use of Force.pdf | 1.3M |
| The Federal Structure of the Republic of Reasons.pdf | 2.7M |
| The Future of Religion.pdf | 648K |
| The Horn of Since the Cold War.pdf | 165K |
| The Implications of Vertical and Horizontal Inequality.pdf | 580K |
| The Individual in International Law.pdf | 165K |
| The International Law of Environmental Impact Assessment.pdf | 1.5M |
| The Introveretd.pdf | 751K |
| The Linkage Between DDR and SSR.pdf | 260K |
| The Literature in Nigerian Federalism_A Critical Appraisal.pdf | 2.2M |
| The Middle East and theory of Conflict.pdf | 1.6M |
| The News Media and the Transformation of Ethnopolitical Conflicts.pdf | 221K |
| The Oslo Accord.pdf | 2.0M |
| The Paradox of Ethnicization and Assimilation.pdf | 82K |
| The Political Approach to Institutional Formation, Maintainace and Change.pdf | 404K |
| The Political Economy of Civil War.pdf | 402K |
| The Political Economy of North South Relations.pdf | 57K |
| The Politics of International Development.pdf | 303K |
| The Quality of Governament and Civil War.pdf | 1.0M |
| The Relevance of International Law.pdf | 2.4M |
| The Resolution of Ethnic Conflict_Towards Typology.pdf | 385K |
| The Road to Peace.pdf | 552K |
| The Role of AU in Peacekeeping Operations.pdf | 333K |
| The Role of Assymetric Federalism.pdf | 116K |
| The Role of Development Aid in Conflict Transformation.pdf | 280K |
| The Role of Ordinary People in Democratization.pdf | 129K |
| The Role of the Diaspora in Capacity Building and Development.pdf | 2.7M |
| The Social Contract.pdf | 272K |
| The State of World Population.pdf | 2.5M |
| The Training Process.pdf | 262K |
| The_Age_of_Imperialism_the_Economics_of_U_S__Foreign_Policy.pdf | 67M |
| The_Architecture_of_Democracy__Constitutional_Design__Conflict_Management__and_Democracy__Oxford_Studies_in_Democratization_.pdf | 2.5M |
| The_Benefits_of_Federalism.pdf | 8.6M |
| The_Bottom_Billion__Why_the_Poorest_Countries_are_Failing_and_What_Can_Be_Done_About_It.pdf | 1.0M |
| The_Bush_Administrations_and_Saddam_Hussein__Deciding_on_Conflict__Advances_in_Foreign_Policy_Analysis_.pdf | 612K |
| The_CIA's_Greatest_Hits.pdf | 418K |
| The_Clash_of_Civilizations_and_the_Remaking_of_World_Order (2).pdf | 5.3M |
| The_Clash_of_Civilizations_and_the_Remaking_of_World_Order.pdf | 5.3M |
| The_Concepts_and_Theories_of_Modern_Democracy.pdf | 1.4M |
| The_Congo_Wars__Conflict__Myth_and_Reality.pdf | 1.1M |
| The_Crisis_of_Democracy__Report_on_the_Governability_of_Democracies_to_the_Trilateral_Commission.pdf | 10M |
| The_Democracy_Advantage__How_Democracies_Promote_Prosperity_and_Peace.pdf | 1.7M |
| The_Dubious_Link__Civic_Engagement_and_Democratization.pdf | 1.0M |
| The_East_Asian_Miracle__Economic_Growth_and_Public_Policy__World_Bank_Policy_Research_Reports_.pdf | 32M |
| The_Ethics_of_Foreign_Policy__Ethics_and_Global_Politics_.pdf | 1.6M |
| The_Evolution_of_Civilizations.pdf | 2.3M |
| The_Foreign_Policy_of_the_Russian_Federation.pdf | 34M |
| The_Foundations_of_Ethnic_Politics__Separatism_of_States_and_Nations_in_Eurasia_and_the_World__Cambridge_Studies_in_Comparative_Politics_.pdf | 11M |
| The_Future_of_Political_Islam.pdf | 1.4M |
| The_Global_Commonwealth_of_Citizens__Toward_Cosmopolitan_Democracy.pdf | 2.0M |
| The_Global_Diffusion_of_Markets_and_Democracy.pdf | 3.7M |
| The_Globalization_of_Corporate_Media_Hegemony__Suny_Series_in_Global_Media_Studies_.pdf | 1.7M |
| The_Globalization_of_World_Politics__An_Introduction_to_International_Relations__2nd_ed_.pdf | 25M |
| The_Globalizing_of_America__1913_1945__Cambridge_History_of_American_Foreign_Relations__Volume_3_.pdf | 14M |
| The_International_Constraints_on_Regime_Changes__How_Globalization_Hinders_the_Prospects_for_Democratization.pdf | 1.2M |
| The_International_Politics_of_the_Middle_East__Regional_International_Politics_Series_ (1).pdf | 1.5M |
| The_International_Politics_of_the_Middle_East__Regional_International_Politics_Series_ (2).pdf | 1.5M |
| The_International_Politics_of_the_Middle_East__Regional_International_Politics_Series_.pdf | 1.5M |
| The_Judge_in_a_Democracy.pdf | 1.0M |
| The_Least_Developed_Countries_Report_2009__The_State_and_Development_Governance__United_Nations_Conference_on_Trade_and_Development_.pdf | 1.1M |
| The_Level_of_Analysis_Problem_in_International_Politics.pdf | 355K |
| The_Middle_East_in_International_Relations__Power__Politics_and_Ideology__The_Contemporary_Middle_East_.pdf | 3.3M |
| The_Moral_Dimension_of_Asymmetrical_Warfare__Counter_terrorism__Democratic_Values_and_Military_Ethics.pdf | 2.7M |
| The_Moral_Foundations_of_Politics__The_Institution_for_Social_and_Policy_St_.pdf | 1.0M |
| The_New_Foreign_Policy__Power_Seeking_in_a_Globalized_Era__New_Millennium_Books_in_International_Studies_.pdf | 1.4M |
| The_New_Global_Trading_Order__The_Evolving_State_and_the_Future_of_Trade.pdf | 1.6M |
| The_New_Politics_of_Conflict_Resolution__Responding_to_Difference__Rethinking_Peace_and_Conflict_Studies_.pdf | 700K |
| The_New_Politics_of_Inequality_in_Latin_America__Rethinking_Participation_and_Representation__Oxford_Studies_in_Democratization_.pdf | 41M |
| The_Political_Class_in_Advanced_Democracies__A_Comparative_Handbook.pdf | 2.2M |
| The_Political_and_Social_Thought_of_Kwame_Nkrumah.pdf | 1.5M |
| The_Politics_of_Aid_Selectivity__Good_Governance_Criteria_in_World_Bank__U_S__and_Dutch_Development_Assistance__Routledge_Studies_in_Development_Econo.pdf | 954K |
| The_Politics_of_Central_Europe__SAGE_Politics_Texts_series_.pdf | 4.7M |
| The_Politics_of_Latin_American_Development__Third_Edition.pdf | 6.2M |
| The_Politics_of_Transition_in_Central_Asia_and_the_Caucasus__Enduring_Legacies_and_Emerging_Challenges__Central_Asian_Studies_.pdf | 1.7M |
| The_Quest_for_Democracy_in_Iran__A_Century_of_Struggle_against_Authoritarian_Rule.pdf | 1.5M |
| The_Separation_of_Powers_and_Legislative_Interference_in_Judicial_Process__Constitutional_Principles_and_Limitations.pdf | 1.8M |
| The_Soul_of_a_Leader__Character__Conviction__and_Ten_Lessons_in_Political_Greatness.pdf | 1.5M |
| The_South_in_World_Politics.pdf | 1.0M |
| The_Specter_of_Democracy.pdf | 2.2M |
| The_State_and_International_Relations__Themes_in_International_Relations_.pdf | 7.3M |
| The_Third_Wave_of_Democratization_in_Latin_America__Advances_and_Setbacks.pdf | 3.6M |
| The_War_Over_Iraq__Saddam's_Tyranny_and_America's_Mission.pdf | 1.5M |
| The_dilemmas_of_statebuilding__confronting_the_contradictions_of_postwar_peace_operations.pdf | 2.9M |
| The economist.pdf | 53M |
| The meaning and Usage of Ethnicization.pdf | 121K |
| Theoretical Reflections on Federations and Federalism.pdf | 213K |
| Theories_of_Development__Second_Edition__Contentions__Arguments__Alternatives.pdf | 1.3M |
| Theories of Change in Conflict Interventions.pdf | 236K |
| Theories of Conflct.pdf | 888K |
| Theorizing_European_Integration__SAGE_Politics_Texts_series_.pdf | 1.2M |
| Theory_and_Evidence_in_Comparative_Politics_and_International_Relations__New_Visions_in_Security_.pdf | 1.3M |
| Think_Tanks_and_Power_in_Foreign_Policy__A_Comparative_Study_of_the_Role_and_Influence_of_the_Council_on_Foreign_Relations_and_the__Royal_Institure_of.pdf | 1.5M |
| Thomas Piane.pdf | 1.4M |
| Thr Camging of foreign Polict.Pdf | 214K |
| Tolerance Background Reading.pdf | 393K |
| Tolerance for Diversity.pdf | 192K |
| Topics in International Law.pdf | 1.3M |
| Torture_and_Democracy.pdf | 3.2M |
| Towards Structural Realism.pdf | 336K |
| Trade__Aid_and_Security__An_Agenda_for_Peace_and_Development.pdf | 1.2M |
| Traditional Approaches to Conflict Transformation.pdf | 288K |
| Tragedy_and_Citizenship__Conflict__Reconciliation__and_Democracy_from_Haemon_to_Hegel.pdf | 4.6M |
| Training for Conflict Transformation.pdf | 463K |
| Training for Peacebuilding and Conflict Transformation.pdf | 618K |
| Training gor Peacebuilding.pdf | 618K |
| Transforming Cultural Conflict in An Age of Complexity.pdf | 601K |
| Transforming War Economies.pdf | 1.0M |
| Transitional Justice.pdf | 108K |
| Transition from Violence to Peace.pdf | 950K |
| Transnational_Democracy__Transnationalism_.pdf | 1.0M |
| Transparency and accountability in government.pdf | 198K |
| Trends and Causes of Armed Conflict.pdf | 217K |
| Trends in Conflict and cooperation.pdf | 640K |
| Trends in Security Sector Reform.pdf | 273K |
| Triangulation in Social Science Research.pdf | 281K |
| Typology of Armed Conflict.pdf | 394K |
| UNAMID.pdf | 290K |
| UNAMID Deployment on the Brink.pdf | 847K |
| UNESCO-Human-Rights-Intruments.pdf | 779K |
| UN Peace Operations in the 21st Century.pdf | 460K |
| UN Peacebuilding Operations.pdf | 425K |
| UN Peacekeepin Operations in DR Congo.pdf | 917K |
| US-Israel.pdf | 1.0M |
| US FEDERALISM.pdf | 39K |
| USIP Catalogue 2010.pdf | 17M |
| Understanding Community Policing.pdf | 365K |
| Understanding Conflict.pdf | 1.0M |
| Understanding_Comparative_Politics__A_Framework_for_Analysis.pdf | 2.2M |
| Understanding_Conflict_and_Conflict_Analysis.pdf | 1.1M |
| Understanding_Foreign_Policy_Decision_Making (2).pdf | 1.0M |
| Understanding_Foreign_Policy_Decision_Making.pdf | 1.0M |
| Urban unemployment.pdf | 397K |
| Using_Quantitative_and_Qualitative_Models_to_Forcast_Instability.pdf | 265K |
| Using the Media for Conflict Transformation.pdf | 565K |
| Values and Value Tradeoffs in Federalism.pdf | 1.9M |
| Vienna Convention on Succesation of States in Respect of Treaties.pdf | 406K |
| Vienna Convention on the Law of Treaties.pdf | 596K |
| Violence and the Social Construction of Ethnic Identity.pdf | 281K |
| Vital_Democracy__A_Theory_of_Democracy_in_Action.pdf | 913K |
| Voting_for_Autocracy__Hegemonic_Party_Survival_and_its_Demise_in_Mexico__Cambridge_Studies_in_Comparative_Politics_.pdf | 1.5M |
| Vulnerability_and_Violence__The_Impact_of_Globalization.pdf | 807K |
| Wahabism and Salafiyya.pdf | 73K |
| Wahhabism-Salafism-and-Islamism.pdf | 219K |
| Walter Rodney-How Europe Underdevelope Africs.pdf | 1.0M |
| War Crimes.pdf | 6.3M |
| Wars__Guns__and_Votes__Democracy_in_Dangerous_Places.pdf | 1.0M |
| Water_and_Local_Conflict_Literature review.pdf | 294K |
| Water and Politics.pdf | 4.4M |
| Westphalian Assumptions of International Law.pdf | 110K |
| We the Children_K Annan.pdf | 1.0M |
| What is Dialectic.pdf | 271K |
| What is the foreign Ministry.pdf | 209K |
| Why Leaders Lie The Truth About Lying in International Politics[1].pdf | 943K |
| Why Minorities Rebel.pdf | 833K |
| Why_Dominant_Parties_Lose__Mexico's_Democratization_in_Comparative_Perspective.pdf | 1.4M |
| Why are Federal Arrangements not a Panacea.pdf | 148K |
| Why they Fight.pdf | 253K |
| Wilsonianism.pdf | 485K |
| Wome and Right to Food.pdf | 687K |
| Women's Participation in Peace Processes.pdf | 80K |
| Women in Somalia.pdf | 1.9M |
| World Peacekeeping.pdf | 5.4M |
| conflict transformation and a Just Peace.pdf | 244K |
| conflict transformation through Educational and Youth Programs.pdf | 661K |
| international_Economic_Law.pdf | 192K |
| shifts, conceptual WID to GAD.pdf | 558K |
| the Challenges of Pluralism.pdf | 1.3M |
